C19H26N2O4 — CID 110019108
2-methyl-1-morpholin-4-yl-3-[(5-phenoxyfuran-2-yl)methylamino]propan-2-ol (PubChem CID 110019108) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-methyl-1-morpholin-4-yl-3-[(5-phenoxyfuran-2-yl)methylamino]propan-2-ol.
| Compound Name | 2-methyl-1-morpholin-4-yl-3-[(5-phenoxyfuran-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 110019108 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-methyl-1-morpholin-4-yl-3-[(5-phenoxyfuran-2-yl)methylamino]propan-2-ol |
| SMILES | CC(O)(CNCc1ccc(Oc2ccccc2)o1)CN1CCOCC1 |
| InChI | InChI=1S/C19H26N2O4/c1-19(22,15-21-9-11-23-12-10-21)14-20-13-17-7-8-18(25-17)24-16-5-3-2-4-6-16/h2-8,20,22H,9-15H2,1H3 |
| InChIKey | GIHLYWJWCFANIG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |