About 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol
2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 111468248) has the molecular formula C13H23N3O2S
and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol.
Molecular Properties
| Compound Name | 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol |
| PubChem CID | 111468248 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | Cc1ncsc1CNCC(C)(O)CN1CCOCC1 |
| InChI | InChI=1S/C13H23N3O2S/c1-11-12(19-10-15-11)7-14-8-13(2,17)9-16-3-5-18-6-4-16/h10,14,17H,3-9H2,1-2H3 |
| InChIKey | FQBNVDGBNDOOFQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol?
The IUPAC name of 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol (CID 111468248) is 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol.
What is the SMILES notation for 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol?
The canonical SMILES for 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol is Cc1ncsc1CNCC(C)(O)CN1CCOCC1.
What is the InChIKey of 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol?
The InChIKey is FQBNVDGBNDOOFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2S/c1-11-12(19-10-15-11)7-14-8-13(2,17)9-16-3-5-18-6-4-16/h10,14,17H,3-9H2,1-2H3.
What are the key properties of 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol?
2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol has a molecular weight of 285.41 g/mol, XLogP of 0.62, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methylamino]-3-morpholin-4-ylpropan-2-ol is sourced from PubChem (CID 111468248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).