C14H23F3N2O2 — CID 110019881
2-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 110019881) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110019881 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | CC(O)C1CCN(CC(=O)N2CCCC(C(F)(F)F)C2)C1 |
| InChI | InChI=1S/C14H23F3N2O2/c1-10(20)11-4-6-18(7-11)9-13(21)19-5-2-3-12(8-19)14(15,16)17/h10-12,20H,2-9H2,1H3 |
| InChIKey | MOLDJJAXUGJIQP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |