C18H24FNO4 — CID 11002231
ethyl 2-cyano-5,5-diethoxy-3-(4-fluorophenyl)pentanoate (PubChem CID 11002231) has the molecular formula C18H24FNO4 and a molecular weight of 337.39 g/mol. Its IUPAC name is ethyl 2-cyano-5,5-diethoxy-3-(4-fluorophenyl)pentanoate.
| Compound Name | ethyl 2-cyano-5,5-diethoxy-3-(4-fluorophenyl)pentanoate |
|---|---|
| PubChem CID | 11002231 |
| Molecular Formula | C18H24FNO4 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | ethyl 2-cyano-5,5-diethoxy-3-(4-fluorophenyl)pentanoate |
| SMILES | CCOC(=O)C(C#N)C(CC(OCC)OCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FNO4/c1-4-22-17(23-5-2)11-15(13-7-9-14(19)10-8-13)16(12-20)18(21)24-6-3/h7-10,15-17H,4-6,11H2,1-3H3 |
| InChIKey | GCJHNZGFNMVYMH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|