C21H25NO2 — CID 110025511
1-(3-benzylpyrrolidin-1-yl)-3-hydroxy-3-phenylbutan-1-one (PubChem CID 110025511) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(3-benzylpyrrolidin-1-yl)-3-hydroxy-3-phenylbutan-1-one.
| Compound Name | 1-(3-benzylpyrrolidin-1-yl)-3-hydroxy-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 110025511 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-(3-benzylpyrrolidin-1-yl)-3-hydroxy-3-phenylbutan-1-one |
| SMILES | CC(O)(CC(=O)N1CCC(Cc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-21(24,19-10-6-3-7-11-19)15-20(23)22-13-12-18(16-22)14-17-8-4-2-5-9-17/h2-11,18,24H,12-16H2,1H3 |
| InChIKey | BABCBOFHTCIPKB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |