C21H25NO2 — CID 166612520
1-[3-[(4-hydroxyphenyl)methyl]pyrrolidin-1-yl]-2-methyl-2-phenylpropan-1-one (PubChem CID 166612520) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[3-[(4-hydroxyphenyl)methyl]pyrrolidin-1-yl]-2-methyl-2-phenylpropan-1-one.
| Compound Name | 1-[3-[(4-hydroxyphenyl)methyl]pyrrolidin-1-yl]-2-methyl-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 166612520 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-[3-[(4-hydroxyphenyl)methyl]pyrrolidin-1-yl]-2-methyl-2-phenylpropan-1-one |
| SMILES | CC(C)(C(=O)N1CCC(Cc2ccc(O)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-21(2,18-6-4-3-5-7-18)20(24)22-13-12-17(15-22)14-16-8-10-19(23)11-9-16/h3-11,17,23H,12-15H2,1-2H3 |
| InChIKey | SYQYGXOHKGKOQV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |