C24H32N2O4 — CID 68972515
4-[(4-tert-butylphenyl)methyl]piperidine-1-carboxylic acid;4-hydroxybenzamide (PubChem CID 68972515) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-[(4-tert-butylphenyl)methyl]piperidine-1-carboxylic acid;4-hydroxybenzamide.
| Compound Name | 4-[(4-tert-butylphenyl)methyl]piperidine-1-carboxylic acid;4-hydroxybenzamide |
|---|---|
| PubChem CID | 68972515 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 4-[(4-tert-butylphenyl)methyl]piperidine-1-carboxylic acid;4-hydroxybenzamide |
| SMILES | CC(C)(C)c1ccc(CC2CCN(C(=O)O)CC2)cc1.NC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H25NO2.C7H7NO2/c1-17(2,3)15-6-4-13(5-7-15)12-14-8-10-18(11-9-14)16(19)20;8-7(10)5-1-3-6(9)4-2-5/h4-7,14H,8-12H2,1-3H3,(H,19,20);1-4,9H,(H2,8,10) |
| InChIKey | VUWDNDLSGVOZEI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |