C17H16F3NO3 — CID 110026135
N-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-2-methoxy-2-phenylacetamide (PubChem CID 110026135) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is N-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-2-methoxy-2-phenylacetamide.
| Compound Name | N-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 110026135 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-2-methoxy-2-phenylacetamide |
| SMILES | COC(C(=O)NC(CO)c1cc(F)c(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C17H16F3NO3/c1-24-16(10-5-3-2-4-6-10)17(23)21-14(9-22)11-7-12(18)15(20)13(19)8-11/h2-8,14,16,22H,9H2,1H3,(H,21,23) |
| InChIKey | XKENNLDUBUUIDV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|