C20H26N2O3 — CID 110026257
N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methyl-2-(N-methylanilino)benzamide (PubChem CID 110026257) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methyl-2-(N-methylanilino)benzamide.
| Compound Name | N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methyl-2-(N-methylanilino)benzamide |
|---|---|
| PubChem CID | 110026257 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-N-methyl-2-(N-methylanilino)benzamide |
| SMILES | CN(CC(C)(CO)CO)C(=O)c1ccccc1N(C)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O3/c1-20(14-23,15-24)13-21(2)19(25)17-11-7-8-12-18(17)22(3)16-9-5-4-6-10-16/h4-12,23-24H,13-15H2,1-3H3 |
| InChIKey | DVQOAYOJVJKFES-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |