C19H19N3O2 — CID 110026460
3-hydroxy-3-phenyl-N'-quinolin-2-ylbutanehydrazide (PubChem CID 110026460) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-hydroxy-3-phenyl-N'-quinolin-2-ylbutanehydrazide.
| Compound Name | 3-hydroxy-3-phenyl-N'-quinolin-2-ylbutanehydrazide |
|---|---|
| PubChem CID | 110026460 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-hydroxy-3-phenyl-N'-quinolin-2-ylbutanehydrazide |
| SMILES | CC(O)(CC(=O)NNc1ccc2ccccc2n1)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O2/c1-19(24,15-8-3-2-4-9-15)13-18(23)22-21-17-12-11-14-7-5-6-10-16(14)20-17/h2-12,24H,13H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | WTZHHIQFGJXFLO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|