C21H26O3Si — CID 11002734
(4R,6S)-4-[dimethyl(phenyl)silyl]-6-(phenylmethoxymethyl)oxan-2-one (PubChem CID 11002734) has the molecular formula C21H26O3Si and a molecular weight of 354.52 g/mol. Its IUPAC name is (4R,6S)-4-[dimethyl(phenyl)silyl]-6-(phenylmethoxymethyl)oxan-2-one.
| Compound Name | (4R,6S)-4-[dimethyl(phenyl)silyl]-6-(phenylmethoxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 11002734 |
| Molecular Formula | C21H26O3Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (4R,6S)-4-[dimethyl(phenyl)silyl]-6-(phenylmethoxymethyl)oxan-2-one |
| SMILES | C[Si](C)(c1ccccc1)[C@H]1CC(=O)O[C@H](COCc2ccccc2)C1 |
| InChI | InChI=1S/C21H26O3Si/c1-25(2,19-11-7-4-8-12-19)20-13-18(24-21(22)14-20)16-23-15-17-9-5-3-6-10-17/h3-12,18,20H,13-16H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | BGLWJLDRVJEYJD-AZUAARDMSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|