C32H40O4Si — CID 10984122
[(1R)-1,2,2-triphenyl-2-trimethylsilyloxyethyl] (2S,3S,4R)-2,3,4-trimethyl-5-oxohexanoate (PubChem CID 10984122) has the molecular formula C32H40O4Si and a molecular weight of 516.75 g/mol. Its IUPAC name is [(1R)-1,2,2-triphenyl-2-trimethylsilyloxyethyl] (2S,3S,4R)-2,3,4-trimethyl-5-oxohexanoate.
| Compound Name | [(1R)-1,2,2-triphenyl-2-trimethylsilyloxyethyl] (2S,3S,4R)-2,3,4-trimethyl-5-oxohexanoate |
|---|---|
| PubChem CID | 10984122 |
| Molecular Formula | C32H40O4Si |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | [(1R)-1,2,2-triphenyl-2-trimethylsilyloxyethyl] (2S,3S,4R)-2,3,4-trimethyl-5-oxohexanoate |
| SMILES | CC(=O)[C@H](C)[C@H](C)[C@H](C)C(=O)O[C@H](c1ccccc1)C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H40O4Si/c1-23(24(2)26(4)33)25(3)31(34)35-30(27-17-11-8-12-18-27)32(36-37(5,6)7,28-19-13-9-14-20-28)29-21-15-10-16-22-29/h8-25,30H,1-7H3/t23-,24+,25-,30+/m0/s1 |
| InChIKey | XDFNWMKNUBJZCW-YDXRHMNESA-N |
| XLogP | 7.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|