C29H33F3O4Si — CID 15536602
[(1R)-1,2,2-triphenyl-2-trimethylsilyloxyethyl] (2S,3R)-4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutanoate (PubChem CID 15536602) has the molecular formula C29H33F3O4Si and a molecular weight of 530.66 g/mol. Its IUPAC name is [(1R)-1,2,2-triphenyl-2-trimethylsilyloxyethyl] (2S,3R)-4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutanoate.
| Compound Name | [(1R)-1,2,2-triphenyl-2-trimethylsilyloxyethyl] (2S,3R)-4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 15536602 |
| Molecular Formula | C29H33F3O4Si |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [(1R)-1,2,2-triphenyl-2-trimethylsilyloxyethyl] (2S,3R)-4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutanoate |
| SMILES | C[C@H](C(=O)O[C@H](c1ccccc1)C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1)[C@@](C)(O)C(F)(F)F |
| InChI | InChI=1S/C29H33F3O4Si/c1-21(27(2,34)29(30,31)32)26(33)35-25(22-15-9-6-10-16-22)28(36-37(3,4)5,23-17-11-7-12-18-23)24-19-13-8-14-20-24/h6-21,25,34H,1-5H3/t21-,25-,27-/m1/s1 |
| InChIKey | FSIFECSXBTXANI-FZBZCGEPSA-N |
| XLogP | 7.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|