C35H44O4Si — CID 11330389
ethyl (2Z,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-trityloxyocta-2,4-dienoate (PubChem CID 11330389) has the molecular formula C35H44O4Si and a molecular weight of 556.82 g/mol. Its IUPAC name is ethyl (2Z,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-trityloxyocta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-trityloxyocta-2,4-dienoate |
|---|---|
| PubChem CID | 11330389 |
| Molecular Formula | C35H44O4Si |
| Molecular Weight | 556.82 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | ethyl (2Z,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-trityloxyocta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C\C=C\C[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H44O4Si/c1-7-37-33(36)27-19-11-18-26-32(39-40(5,6)34(2,3)4)28-38-35(29-20-12-8-13-21-29,30-22-14-9-15-23-30)31-24-16-10-17-25-31/h8-25,27,32H,7,26,28H2,1-6H3/b18-11+,27-19-/t32-/m0/s1 |
| InChIKey | FIHZWDFSYIMKCI-RJBAHQDGSA-N |
| XLogP | 8.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.82 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|