C20H27N3O — CID 110027663
1-[1-(2-phenylethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]hex-5-en-2-ol (PubChem CID 110027663) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-[1-(2-phenylethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]hex-5-en-2-ol.
| Compound Name | 1-[1-(2-phenylethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 110027663 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-[1-(2-phenylethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN1CCc2c(ncn2CCc2ccccc2)C1 |
| InChI | InChI=1S/C20H27N3O/c1-2-3-9-18(24)14-22-12-11-20-19(15-22)21-16-23(20)13-10-17-7-5-4-6-8-17/h2,4-8,16,18,24H,1,3,9-15H2 |
| InChIKey | CIFUQWBHRRDDGF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|