C17H22N4O — CID 139010761
1-(1-phenyl-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl)hex-5-en-2-ol (PubChem CID 139010761) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(1-phenyl-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl)hex-5-en-2-ol.
| Compound Name | 1-(1-phenyl-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 139010761 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-(1-phenyl-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl)hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN1CCc2c(nnn2-c2ccccc2)C1 |
| InChI | InChI=1S/C17H22N4O/c1-2-3-9-15(22)12-20-11-10-17-16(13-20)18-19-21(17)14-7-5-4-6-8-14/h2,4-8,15,22H,1,3,9-13H2 |
| InChIKey | MAMIDCVYWJZUIC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|