C23H32N4O — CID 93226210
(2R)-1-[4-(5-benzyl-2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]hex-5-en-2-ol (PubChem CID 93226210) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is (2R)-1-[4-(5-benzyl-2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]hex-5-en-2-ol.
| Compound Name | (2R)-1-[4-(5-benzyl-2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93226210 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (2R)-1-[4-(5-benzyl-2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]hex-5-en-2-ol |
| SMILES | C=CCC[C@@H](O)CN1CCN(c2nc(C)nc(C)c2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N4O/c1-4-5-11-21(28)17-26-12-14-27(15-13-26)23-22(18(2)24-19(3)25-23)16-20-9-7-6-8-10-20/h4,6-10,21,28H,1,5,11-17H2,2-3H3/t21-/m1/s1 |
| InChIKey | KSQPJBJZCKKUBM-OAQYLSRUSA-N |
| XLogP | 3.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|