C23H31FN4O — CID 93226005
(2S)-1-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]piperazin-1-yl]hex-5-en-2-ol (PubChem CID 93226005) has the molecular formula C23H31FN4O and a molecular weight of 398.53 g/mol. Its IUPAC name is (2S)-1-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]piperazin-1-yl]hex-5-en-2-ol.
| Compound Name | (2S)-1-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]piperazin-1-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93226005 |
| Molecular Formula | C23H31FN4O |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (2S)-1-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]piperazin-1-yl]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN1CCN(c2nc(C)nc(C)c2Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H31FN4O/c1-4-5-9-21(29)16-27-10-12-28(13-11-27)23-22(17(2)25-18(3)26-23)15-19-7-6-8-20(24)14-19/h4,6-8,14,21,29H,1,5,9-13,15-16H2,2-3H3/t21-/m0/s1 |
| InChIKey | NYUCISYUEGSYAO-NRFANRHFSA-N |
| XLogP | 3.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|