C24H35FN4O2 — CID 93226021
(2S)-1-butoxy-3-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]piperazin-1-yl]propan-2-ol (PubChem CID 93226021) has the molecular formula C24H35FN4O2 and a molecular weight of 430.57 g/mol. Its IUPAC name is (2S)-1-butoxy-3-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]piperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-butoxy-3-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 93226021 |
| Molecular Formula | C24H35FN4O2 |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (2S)-1-butoxy-3-[4-[5-[(3-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]piperazin-1-yl]propan-2-ol |
| SMILES | CCCCOC[C@@H](O)CN1CCN(c2nc(C)nc(C)c2Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C24H35FN4O2/c1-4-5-13-31-17-22(30)16-28-9-11-29(12-10-28)24-23(18(2)26-19(3)27-24)15-20-7-6-8-21(25)14-20/h6-8,14,22,30H,4-5,9-13,15-17H2,1-3H3/t22-/m0/s1 |
| InChIKey | JAJYXMARDWWJPF-QFIPXVFZSA-N |
| XLogP | 3.12 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|