C26H40N4O2 — CID 46029694
1-butoxy-3-[4-[6-ethyl-2-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]propan-2-ol (PubChem CID 46029694) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 1-butoxy-3-[4-[6-ethyl-2-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-butoxy-3-[4-[6-ethyl-2-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 46029694 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | 1-butoxy-3-[4-[6-ethyl-2-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]propan-2-ol |
| SMILES | CCCCOCC(O)CN1CCN(c2nc(C)nc(CC)c2Cc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C26H40N4O2/c1-5-7-16-32-19-23(31)18-29-12-14-30(15-13-29)26-24(25(6-2)27-21(4)28-26)17-22-10-8-20(3)9-11-22/h8-11,23,31H,5-7,12-19H2,1-4H3 |
| InChIKey | RDROBFIDUQXCSZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|