C24H34N4O — CID 42682772
1-[4-[2,6-dimethyl-5-[(3-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]hex-5-en-2-ol (PubChem CID 42682772) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[4-[2,6-dimethyl-5-[(3-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]hex-5-en-2-ol.
| Compound Name | 1-[4-[2,6-dimethyl-5-[(3-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 42682772 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1-[4-[2,6-dimethyl-5-[(3-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN1CCN(c2nc(C)nc(C)c2Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C24H34N4O/c1-5-6-10-22(29)17-27-11-13-28(14-12-27)24-23(19(3)25-20(4)26-24)16-21-9-7-8-18(2)15-21/h5,7-9,15,22,29H,1,6,10-14,16-17H2,2-4H3 |
| InChIKey | BPXKULBAUNQREP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|