C20H32IN5 — CID 110029033
1-(6-methylheptan-2-yl)-2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 110029033) has the molecular formula C20H32IN5 and a molecular weight of 469.42 g/mol. Its IUPAC name is 1-(6-methylheptan-2-yl)-2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(6-methylheptan-2-yl)-2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110029033 |
| Molecular Formula | C20H32IN5 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 1-(6-methylheptan-2-yl)-2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CC(C)CCCC(C)N/C(N)=N/Cc1cn(C)nc1-c1ccccc1.I |
| InChI | InChI=1S/C20H31N5.HI/c1-15(2)9-8-10-16(3)23-20(21)22-13-18-14-25(4)24-19(18)17-11-6-5-7-12-17;/h5-7,11-12,14-16H,8-10,13H2,1-4H3,(H3,21,22,23);1H |
| InChIKey | PLABOQXKTRSRHV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|