C16H20FIN4O — CID 110030887
1-cyclopropyl-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1-methylguanidine;hydroiodide (PubChem CID 110030887) has the molecular formula C16H20FIN4O and a molecular weight of 430.27 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110030887 |
| Molecular Formula | C16H20FIN4O |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-cyclopropyl-2-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCc1coc(-c2ccc(F)cc2)n1)C1CC1.I |
| InChI | InChI=1S/C16H19FN4O.HI/c1-21(14-6-7-14)16(18)19-9-8-13-10-22-15(20-13)11-2-4-12(17)5-3-11;/h2-5,10,14H,6-9H2,1H3,(H2,18,19);1H |
| InChIKey | POUZJIONLIEMNO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|