C23H29FOSi — CID 11003142
triethyl-[(8-fluoro-3,15-dimethyl-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaenyl)oxy]silane (PubChem CID 11003142) has the molecular formula C23H29FOSi and a molecular weight of 368.57 g/mol. Its IUPAC name is triethyl-[(8-fluoro-3,15-dimethyl-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaenyl)oxy]silane.
| Compound Name | triethyl-[(8-fluoro-3,15-dimethyl-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaenyl)oxy]silane |
|---|---|
| PubChem CID | 11003142 |
| Molecular Formula | C23H29FOSi |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | triethyl-[(8-fluoro-3,15-dimethyl-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaenyl)oxy]silane |
| SMILES | CC[Si](CC)(CC)OC1=C(F)c2cccc(C)c2-c2c(C)cccc2C1 |
| InChI | InChI=1S/C23H29FOSi/c1-6-26(7-2,8-3)25-20-15-18-13-9-11-16(4)21(18)22-17(5)12-10-14-19(22)23(20)24/h9-14H,6-8,15H2,1-5H3 |
| InChIKey | QTZYHRDEZNVPSL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|