C22H20N4O2 — CID 11003236
4-benzyl-3-methyl-5-(4-nitrophenyl)-2-phenyl-3H-1,2,4-triazole (PubChem CID 11003236) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-benzyl-3-methyl-5-(4-nitrophenyl)-2-phenyl-3H-1,2,4-triazole.
| Compound Name | 4-benzyl-3-methyl-5-(4-nitrophenyl)-2-phenyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 11003236 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-benzyl-3-methyl-5-(4-nitrophenyl)-2-phenyl-3H-1,2,4-triazole |
| SMILES | CC1N(Cc2ccccc2)C(c2ccc([N+](=O)[O-])cc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C22H20N4O2/c1-17-24(16-18-8-4-2-5-9-18)22(19-12-14-21(15-13-19)26(27)28)23-25(17)20-10-6-3-7-11-20/h2-15,17H,16H2,1H3 |
| InChIKey | XCPOUCZJGDLDQZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|