C15H21IN4OS — CID 110032961
1-(4-methoxyphenyl)-2-[2-(5-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 110032961) has the molecular formula C15H21IN4OS and a molecular weight of 432.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[2-(5-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(4-methoxyphenyl)-2-[2-(5-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110032961 |
| Molecular Formula | C15H21IN4OS |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[2-(5-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CC(C)c2ncc(C)s2)cc1.I |
| InChI | InChI=1S/C15H20N4OS.HI/c1-10(14-17-9-11(2)21-14)8-18-15(16)19-12-4-6-13(20-3)7-5-12;/h4-7,9-10H,8H2,1-3H3,(H3,16,18,19);1H |
| InChIKey | NMYVXXXDGOJLMT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|