C17H23N5O — CID 142888276
1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-methoxyphenyl)propyl]guanidine (PubChem CID 142888276) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-methoxyphenyl)propyl]guanidine.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-methoxyphenyl)propyl]guanidine |
|---|---|
| PubChem CID | 142888276 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-2-[2-(4-methoxyphenyl)propyl]guanidine |
| SMILES | COc1ccc(C(C)C/N=C(\N)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C17H23N5O/c1-11(14-5-7-15(23-4)8-6-14)10-19-16(18)22-17-20-12(2)9-13(3)21-17/h5-9,11H,10H2,1-4H3,(H3,18,19,20,21,22) |
| InChIKey | ARRDFBQBWMBBBP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|