C18H26N6O2 — CID 142888271
2-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-(4-methoxy-6-methylpyrimidin-2-yl)guanidine (PubChem CID 142888271) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-(4-methoxy-6-methylpyrimidin-2-yl)guanidine.
| Compound Name | 2-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-(4-methoxy-6-methylpyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 142888271 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-(4-methoxy-6-methylpyrimidin-2-yl)guanidine |
| SMILES | COc1cc(C)nc(N/C(N)=N/Cc2ccc(OCCN(C)C)cc2)n1 |
| InChI | InChI=1S/C18H26N6O2/c1-13-11-16(25-4)22-18(21-13)23-17(19)20-12-14-5-7-15(8-6-14)26-10-9-24(2)3/h5-8,11H,9-10,12H2,1-4H3,(H3,19,20,21,22,23) |
| InChIKey | VFCNRDXHEDRSCS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|