C18H16O9 — CID 11003316
methyl (2S,4aS,7R,7aS)-2-(4-methoxyphenyl)-5',6-dioxospiro[4,4a-dihydrofuro[3,2-d][1,3]dioxine-7,2'-furan]-7a-carboxylate (PubChem CID 11003316) has the molecular formula C18H16O9 and a molecular weight of 376.32 g/mol. Its IUPAC name is methyl (2S,4aS,7R,7aS)-2-(4-methoxyphenyl)-5',6-dioxospiro[4,4a-dihydrofuro[3,2-d][1,3]dioxine-7,2'-furan]-7a-carboxylate.
| Compound Name | methyl (2S,4aS,7R,7aS)-2-(4-methoxyphenyl)-5',6-dioxospiro[4,4a-dihydrofuro[3,2-d][1,3]dioxine-7,2'-furan]-7a-carboxylate |
|---|---|
| PubChem CID | 11003316 |
| Molecular Formula | C18H16O9 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | methyl (2S,4aS,7R,7aS)-2-(4-methoxyphenyl)-5',6-dioxospiro[4,4a-dihydrofuro[3,2-d][1,3]dioxine-7,2'-furan]-7a-carboxylate |
| SMILES | COC(=O)[C@]12O[C@@H](c3ccc(OC)cc3)OC[C@@H]1OC(=O)[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C18H16O9/c1-22-11-5-3-10(4-6-11)14-24-9-12-18(27-14,16(21)23-2)17(15(20)25-12)8-7-13(19)26-17/h3-8,12,14H,9H2,1-2H3/t12-,14-,17-,18+/m0/s1 |
| InChIKey | ZTHWQIYYVDABAF-CSBKYJRVSA-N |
| XLogP | 0.43 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|