C20H35N5O3 — CID 110036649
2-[[N-(3-ethoxypropyl)-N'-[[6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110036649) has the molecular formula C20H35N5O3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[[N-(3-ethoxypropyl)-N'-[[6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-(3-ethoxypropyl)-N'-[[6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110036649 |
| Molecular Formula | C20H35N5O3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 2-[[N-(3-ethoxypropyl)-N'-[[6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC(C)(C)C)nc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C20H35N5O3/c1-7-27-12-8-11-21-19(24-15-18(26)25(5)6)23-14-16-9-10-17(22-13-16)28-20(2,3)4/h9-10,13H,7-8,11-12,14-15H2,1-6H3,(H2,21,23,24) |
| InChIKey | LKRRPSMKRPBZDH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|