C23H34IN5O3 — CID 110035696
2-[[N-[(4-methoxyphenyl)methyl]-N'-[[6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110035696) has the molecular formula C23H34IN5O3 and a molecular weight of 555.46 g/mol. Its IUPAC name is 2-[[N-[(4-methoxyphenyl)methyl]-N'-[[6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[(4-methoxyphenyl)methyl]-N'-[[6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110035696 |
| Molecular Formula | C23H34IN5O3 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 2-[[N-[(4-methoxyphenyl)methyl]-N'-[[6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(CN/C(=N/Cc2ccc(OC(C)(C)C)nc2)NCC(=O)N(C)C)cc1.I |
| InChI | InChI=1S/C23H33N5O3.HI/c1-23(2,3)31-20-12-9-18(14-24-20)15-26-22(27-16-21(29)28(4)5)25-13-17-7-10-19(30-6)11-8-17;/h7-12,14H,13,15-16H2,1-6H3,(H2,25,26,27);1H |
| InChIKey | TUIKDJJDPHWUAI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|