C23H33IN4O2 — CID 110037914
N,N-dimethyl-2-[[(1-naphthalen-2-ylethylamino)-(oxan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110037914) has the molecular formula C23H33IN4O2 and a molecular weight of 524.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(1-naphthalen-2-ylethylamino)-(oxan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(1-naphthalen-2-ylethylamino)-(oxan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110037914 |
| Molecular Formula | C23H33IN4O2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | N,N-dimethyl-2-[[(1-naphthalen-2-ylethylamino)-(oxan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(N/C(=N/CC(=O)N(C)C)NCC1CCCCO1)c1ccc2ccccc2c1.I |
| InChI | InChI=1S/C23H32N4O2.HI/c1-17(19-12-11-18-8-4-5-9-20(18)14-19)26-23(25-16-22(28)27(2)3)24-15-21-10-6-7-13-29-21;/h4-5,8-9,11-12,14,17,21H,6-7,10,13,15-16H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | XLLULNDJFXWAFY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|