C19H37N5O3 — CID 110039617
2-[[[[1-(2-ethylbutanoyl)piperidin-4-yl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110039617) has the molecular formula C19H37N5O3 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-[[[[1-(2-ethylbutanoyl)piperidin-4-yl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(2-ethylbutanoyl)piperidin-4-yl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110039617 |
| Molecular Formula | C19H37N5O3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 2-[[[[1-(2-ethylbutanoyl)piperidin-4-yl]amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC(CC)C(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCCOC)CC1 |
| InChI | InChI=1S/C19H37N5O3/c1-6-15(7-2)18(26)24-11-8-16(9-12-24)22-19(20-10-13-27-5)21-14-17(25)23(3)4/h15-16H,6-14H2,1-5H3,(H2,20,21,22) |
| InChIKey | GXUFKDMXPKLPRU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|