C19H36F3N5O2 — CID 111671062
2-[[ethylamino-[(3-ethyl-2-morpholin-4-ylpentyl)amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111671062) has the molecular formula C19H36F3N5O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[[ethylamino-[(3-ethyl-2-morpholin-4-ylpentyl)amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[ethylamino-[(3-ethyl-2-morpholin-4-ylpentyl)amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111671062 |
| Molecular Formula | C19H36F3N5O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 2-[[ethylamino-[(3-ethyl-2-morpholin-4-ylpentyl)amino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NCC(C(CC)CC)N1CCOCC1 |
| InChI | InChI=1S/C19H36F3N5O2/c1-5-15(6-2)16(27-8-10-29-11-9-27)12-24-18(23-7-3)25-13-17(28)26(4)14-19(20,21)22/h15-16H,5-14H2,1-4H3,(H2,23,24,25) |
| InChIKey | PVFOGWPGZDIIEC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|