C18H34F3N5O — CID 110033929
2-[[(butan-2-ylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110033929) has the molecular formula C18H34F3N5O and a molecular weight of 393.50 g/mol. Its IUPAC name is 2-[[(butan-2-ylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(butan-2-ylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110033929 |
| Molecular Formula | C18H34F3N5O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 2-[[(butan-2-ylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)NCCC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H34F3N5O/c1-5-14(2)24-17(23-12-16(27)25(3)4)22-9-6-15-7-10-26(11-8-15)13-18(19,20)21/h14-15H,5-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | HKXYQOCAXZQHAM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|