C18H33F3IN5O — CID 109376888
N-cyclohexyl-2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide;hydroiodide (PubChem CID 109376888) has the molecular formula C18H33F3IN5O and a molecular weight of 519.39 g/mol. Its IUPAC name is N-cyclohexyl-2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclohexyl-2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109376888 |
| Molecular Formula | C18H33F3IN5O |
| Molecular Weight | 519.39 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | N-cyclohexyl-2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H32F3N5O.HI/c1-3-22-17(23-13-16(27)24-15-7-5-4-6-8-15)26-11-9-25(10-12-26)14(2)18(19,20)21;/h14-15H,3-13H2,1-2H3,(H,22,23)(H,24,27);1H |
| InChIKey | CXTAYAFGRBWTNN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|