C18H35F3IN5O — CID 110033928
2-[[(butan-2-ylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110033928) has the molecular formula C18H35F3IN5O and a molecular weight of 521.41 g/mol. Its IUPAC name is 2-[[(butan-2-ylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(butan-2-ylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110033928 |
| Molecular Formula | C18H35F3IN5O |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 2-[[(butan-2-ylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)NCCC1CCN(CC(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H34F3N5O.HI/c1-5-14(2)24-17(23-12-16(27)25(3)4)22-9-6-15-7-10-26(11-8-15)13-18(19,20)21;/h14-15H,5-13H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | VXFDMDBNPBLCTG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|