C19H34F3N5O — CID 110034419
2-[[(cyclopentylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110034419) has the molecular formula C19H34F3N5O and a molecular weight of 405.51 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopentylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110034419 |
| Molecular Formula | C19H34F3N5O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 2-[[(cyclopentylamino)-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCC1CCN(CC(F)(F)F)CC1)NC1CCCC1 |
| InChI | InChI=1S/C19H34F3N5O/c1-26(2)17(28)13-24-18(25-16-5-3-4-6-16)23-10-7-15-8-11-27(12-9-15)14-19(20,21)22/h15-16H,3-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | UTIPVVYDGWJRBM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|