C21H37NO5Si — CID 11004164
tert-butyl (2S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-4-oxobut-2-ynyl]pyrrolidine-1-carboxylate (PubChem CID 11004164) has the molecular formula C21H37NO5Si and a molecular weight of 411.62 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-4-oxobut-2-ynyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-4-oxobut-2-ynyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11004164 |
| Molecular Formula | C21H37NO5Si |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | tert-butyl (2S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethoxy-4-oxobut-2-ynyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C#C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37NO5Si/c1-10-25-18(23)14-13-17(27-28(8,9)21(5,6)7)16-12-11-15-22(16)19(24)26-20(2,3)4/h16-17H,10-12,15H2,1-9H3/t16-,17+/m0/s1 |
| InChIKey | QERXWNBHFQEOOK-DLBZAZTESA-N |
| XLogP | 4.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|