C16H33NO3Si — CID 14629879
tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 14629879) has the molecular formula C16H33NO3Si and a molecular weight of 315.53 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 14629879 |
| Molecular Formula | C16H33NO3Si |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO3Si/c1-15(2,3)20-14(18)17-11-9-10-13(17)12-19-21(7,8)16(4,5)6/h13H,9-12H2,1-8H3/t13-/m0/s1 |
| InChIKey | LYOATBMBFDXPMT-ZDUSSCGKSA-N |
| XLogP | 4.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|