C21H41N5O4 — CID 110044525
tert-butyl N-[[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)carbamimidoyl]piperidin-4-yl]methyl]-N-ethylcarbamate (PubChem CID 110044525) has the molecular formula C21H41N5O4 and a molecular weight of 427.59 g/mol. Its IUPAC name is tert-butyl N-[[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)carbamimidoyl]piperidin-4-yl]methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)carbamimidoyl]piperidin-4-yl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 110044525 |
| Molecular Formula | C21H41N5O4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | tert-butyl N-[[1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)carbamimidoyl]piperidin-4-yl]methyl]-N-ethylcarbamate |
| SMILES | CCN(CC1CCN(/C(=N/CC(=O)N(C)C)NCCOC)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H41N5O4/c1-8-25(20(28)30-21(2,3)4)16-17-9-12-26(13-10-17)19(22-11-14-29-7)23-15-18(27)24(5)6/h17H,8-16H2,1-7H3,(H,22,23) |
| InChIKey | VLGRVRZSWNYBIT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|