C19H33N5O2 — CID 110045061
2-[[N-cyclohexyl-N'-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110045061) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-[[N-cyclohexyl-N'-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-cyclohexyl-N'-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110045061 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 2-[[N-cyclohexyl-N'-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCc1noc(CC)c1C/N=C(\NCC(=O)N(C)C)NC1CCCCC1 |
| InChI | InChI=1S/C19H33N5O2/c1-5-16-15(17(6-2)26-23-16)12-20-19(21-13-18(25)24(3)4)22-14-10-8-7-9-11-14/h14H,5-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | OQYVBFXYXZCDCY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|