C18H34N4O4 — CID 110046025
N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[3-(oxolan-3-yloxy)propylamino]methylidene]amino]acetamide (PubChem CID 110046025) has the molecular formula C18H34N4O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[3-(oxolan-3-yloxy)propylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[3-(oxolan-3-yloxy)propylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110046025 |
| Molecular Formula | C18H34N4O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[3-(oxolan-3-yloxy)propylamino]methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCOC1CCOC1)NCC1CCCCO1 |
| InChI | InChI=1S/C18H34N4O4/c1-22(2)17(23)13-21-18(20-12-15-6-3-4-9-25-15)19-8-5-10-26-16-7-11-24-14-16/h15-16H,3-14H2,1-2H3,(H2,19,20,21) |
| InChIKey | AWPXZQAUPIGPPL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|