C15H30N4O4 — CID 110046051
2-[[(2-methoxyethylamino)-[3-(oxolan-3-yloxy)propylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110046051) has the molecular formula C15H30N4O4 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[[(2-methoxyethylamino)-[3-(oxolan-3-yloxy)propylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-methoxyethylamino)-[3-(oxolan-3-yloxy)propylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110046051 |
| Molecular Formula | C15H30N4O4 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 2-[[(2-methoxyethylamino)-[3-(oxolan-3-yloxy)propylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)NCCCOC1CCOC1 |
| InChI | InChI=1S/C15H30N4O4/c1-19(2)14(20)11-18-15(17-7-10-21-3)16-6-4-8-23-13-5-9-22-12-13/h13H,4-12H2,1-3H3,(H2,16,17,18) |
| InChIKey | GTLDKQZMRBOTFS-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|