C18H37IN4O4 — CID 111647821
2-[[(3-ethoxypropylamino)-[3-(oxolan-3-ylmethoxy)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111647821) has the molecular formula C18H37IN4O4 and a molecular weight of 500.42 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-[3-(oxolan-3-ylmethoxy)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-ethoxypropylamino)-[3-(oxolan-3-ylmethoxy)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111647821 |
| Molecular Formula | C18H37IN4O4 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-[3-(oxolan-3-ylmethoxy)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)NCCCOCC1CCOC1.I |
| InChI | InChI=1S/C18H36N4O4.HI/c1-4-24-10-5-8-19-18(21-13-17(23)22(2)3)20-9-6-11-25-14-16-7-12-26-15-16;/h16H,4-15H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | VSWKTUVCFDVGKM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|