C20H39IN4O2 — CID 110046158
N,N-dimethyl-2-[[[[1-(2-methylpropyl)cyclobutyl]methylamino]-(oxan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110046158) has the molecular formula C20H39IN4O2 and a molecular weight of 494.46 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[1-(2-methylpropyl)cyclobutyl]methylamino]-(oxan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[[1-(2-methylpropyl)cyclobutyl]methylamino]-(oxan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110046158 |
| Molecular Formula | C20H39IN4O2 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N,N-dimethyl-2-[[[[1-(2-methylpropyl)cyclobutyl]methylamino]-(oxan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)CC1(CN/C(=N\CC(=O)N(C)C)NCC2CCCCO2)CCC1.I |
| InChI | InChI=1S/C20H38N4O2.HI/c1-16(2)12-20(9-7-10-20)15-23-19(22-14-18(25)24(3)4)21-13-17-8-5-6-11-26-17;/h16-17H,5-15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | SSPJYSDNZBVTSH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|