C20H28ClN5O — CID 110046531
2-[[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110046531) has the molecular formula C20H28ClN5O and a molecular weight of 389.93 g/mol. Its IUPAC name is 2-[[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110046531 |
| Molecular Formula | C20H28ClN5O |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NCCc1ccccc1)N(C)Cc1cc(Cl)cn1C |
| InChI | InChI=1S/C20H28ClN5O/c1-24(2)19(27)13-23-20(22-11-10-16-8-6-5-7-9-16)26(4)15-18-12-17(21)14-25(18)3/h5-9,12,14H,10-11,13,15H2,1-4H3,(H,22,23) |
| InChIKey | NCRNRRBREPYSKM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|