C22H30N4O3S — CID 110047054
N,N-dimethyl-2-[[N'-[(3-methyl-4-methylsulfonylphenyl)methyl]-N-(2-phenylethyl)carbamimidoyl]amino]acetamide (PubChem CID 110047054) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-[(3-methyl-4-methylsulfonylphenyl)methyl]-N-(2-phenylethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N'-[(3-methyl-4-methylsulfonylphenyl)methyl]-N-(2-phenylethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 110047054 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N,N-dimethyl-2-[[N'-[(3-methyl-4-methylsulfonylphenyl)methyl]-N-(2-phenylethyl)carbamimidoyl]amino]acetamide |
| SMILES | Cc1cc(C/N=C(\NCCc2ccccc2)NCC(=O)N(C)C)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C22H30N4O3S/c1-17-14-19(10-11-20(17)30(4,28)29)15-24-22(25-16-21(27)26(2)3)23-13-12-18-8-6-5-7-9-18/h5-11,14H,12-13,15-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | DTXSSCHHGKVOGQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|