C23H45NO5Si — CID 11004763
(4S)-3-[(2S,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-trimethyloctanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11004763) has the molecular formula C23H45NO5Si and a molecular weight of 443.70 g/mol. Its IUPAC name is (4S)-3-[(2S,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-trimethyloctanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-trimethyloctanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11004763 |
| Molecular Formula | C23H45NO5Si |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | (4S)-3-[(2S,3R,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6-trimethyloctanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)[C@H](C)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C23H45NO5Si/c1-12-15(4)20(29-30(10,11)23(7,8)9)16(5)19(25)17(6)21(26)24-18(14(2)3)13-28-22(24)27/h14-20,25H,12-13H2,1-11H3/t15-,16+,17-,18+,19+,20+/m0/s1 |
| InChIKey | RUXBBDRSTSOXQM-XYWBXWKWSA-N |
| XLogP | 5.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|