C23H45NO4Si — CID 138970673
(4R)-3-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyldecanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 138970673) has the molecular formula C23H45NO4Si and a molecular weight of 427.70 g/mol. Its IUPAC name is (4R)-3-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyldecanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyldecanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138970673 |
| Molecular Formula | C23H45NO4Si |
| Molecular Weight | 427.70 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (4R)-3-[(2S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyldecanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@H](CC[C@H](C)C(=O)N1C(=O)OC[C@H]1C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H45NO4Si/c1-10-11-12-13-19(28-29(8,9)23(5,6)7)15-14-18(4)21(25)24-20(17(2)3)16-27-22(24)26/h17-20H,10-16H2,1-9H3/t18-,19+,20-/m0/s1 |
| InChIKey | APUYXPCBQGZPEH-ZCNNSNEGSA-N |
| XLogP | 6.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|